Index of /gary_zabel/Courses/Spinoza/Texts
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | an ungrammatical mul..> | 2013-07-04 14:43 | - | |
| The Chronicle 11-5-2..> | 2013-07-04 14:43 | - | |
| Spinoza - BDSweb Sp..> | 2013-07-04 14:43 | - | |
| Meyers Konversations..> | 2013-07-04 14:43 | - | |
| Foucault - Order of ..> | 2013-07-04 14:43 | - | |
| Foucault - Foucault ..> | 2013-07-04 14:43 | - | |
| Foucault - Chronolog..> | 2013-07-04 14:43 | - | |
| Epicurus_info E-Tex..> | 2013-07-04 14:43 | - | |
| 20th WCP Bennett on ..> | 2013-07-04 14:43 | - | |
| The Philosophy of Jo..> | 2013-07-04 14:43 | - | |
| Spinoza's Heresy - J..> | 2013-07-04 14:43 | - | |
| Society of Control_f..> | 2013-07-04 14:43 | - | |
| Panentheism_files/ | 2013-07-04 14:43 | - | |
| Multitudes Web - A R..> | 2013-07-04 14:43 | - | |
| Martin Heidegger - N..> | 2013-07-04 14:43 | - | |
| Lucretius De Rerum N..> | 2013-07-04 14:43 | - | |
| Goethean Science IV ..> | 2013-07-04 14:43 | - | |
| Foucault - Order of ..> | 2013-07-04 14:43 | - | |
| Epicurus_info E-Tex..> | 2013-07-04 14:43 | - | |
| Epicurus_info E-Tex..> | 2013-07-04 14:43 | - | |
| Elwes's Introduction..> | 2013-07-04 14:43 | - | |
| Descartes - The Worl..> | 2013-07-04 14:43 | - | |
| DELEUZE SPINOZA 25-1..> | 2013-07-04 14:43 | - | |
| DELEUZE SPINOZA 13-0..> | 2013-07-04 14:43 | - | |
| Benedict Spinoza_files/ | 2013-07-04 14:43 | - | |
| Alain Badiou-Bibliog..> | 2013-07-04 14:43 | - | |
| About Spinoza excerp..> | 2013-07-04 14:43 | - | |
| TPT/ | 2013-07-04 14:43 | - | |
| Multitudes Web - « A..> | 2013-07-04 14:43 | - | |
| 20th WCP Immanence a..> | 2013-07-04 14:43 | - | |
| WAW Moll Antonie van..> | 2013-07-04 14:43 | - | |
| Spinoza's A Politica..> | 2013-07-04 14:43 | - | |
| Multitudes Web - Mul..> | 2013-07-04 14:43 | - | |
| Multitudes Web - « R..> | 2013-07-04 14:43 | - | |
| Lucretius De Rerum N..> | 2013-07-04 14:43 | - | |
| Holland Spinoza and ..> | 2013-07-04 14:43 | - | |
| Full Record -- Conte..> | 2013-07-04 14:43 | - | |
| Franciscus van den E..> | 2013-07-04 14:43 | - | |
| Epicurus_info E-Tex..> | 2013-07-04 14:43 | - | |
| CATHOLIC ENCYCLOPEDI..> | 2013-07-04 14:43 | - | |
| Althusser and the Re..> | 2013-07-04 14:43 | - | |
| Spinozabgv_files/ | 2013-07-04 14:43 | - | |
| Matheron_files/ | 2013-07-04 14:43 | - | |
| Ethics_-_Spinoza/ | 2013-07-04 14:43 | - | |
| The House of Orange_..> | 2013-07-04 14:43 | - | |
| Spinoza1_files/ | 2013-07-04 14:43 | - | |
| Spinoza's A Politica..> | 2013-07-04 14:43 | - | |
| Radical Philosophy -..> | 2013-07-04 14:43 | - | |
| Multitudes Web - Pré..> | 2013-07-04 14:43 | - | |
| Kolakowski On Spinoz..> | 2013-07-04 14:43 | - | |
| Deleuze Spinoza 09-1..> | 2013-07-04 14:43 | - | |
| De Rerum Natura text..> | 2013-07-04 14:43 | - | |
| DELEUZE SPINOZA 24-0..> | 2013-07-04 14:43 | - | |
| Althusser and the Re..> | 2013-07-04 14:43 | - | |
| W24A5_files/ | 2013-07-04 14:43 | - | |
| Structural Causality..> | 2013-07-04 14:43 | - | |
| Lucretius [Internet ..> | 2013-07-04 14:43 | - | |
| Lucretius De Rerum N..> | 2013-07-04 14:43 | - | |
| Althusser and the Re..> | 2013-07-04 14:43 | - | |
| The Existence Machin..> | 2013-07-04 14:43 | - | |
| Spinoza_s political ..> | 2013-07-04 14:43 | - | |
| On Jacobi's Letters ..> | 2013-07-04 14:43 | - | |
| Multitudes Web - Pré..> | 2013-07-04 14:43 | - | |
| Multitudes Web - Mul..> | 2013-07-04 14:43 | - | |
| Multitudes Web - Mar..> | 2013-07-04 14:43 | - | |
| HyperSpinoza_files/ | 2013-07-04 14:43 | - | |
| Epicurus_info E-Tex..> | 2013-07-04 14:43 | - | |
| Epicurus_info E-Tex..> | 2013-07-04 14:43 | - | |
| Alain Badiou_files/ | 2013-07-04 14:43 | - | |
| nikolas von kues_files/ | 2013-07-04 14:43 | - | |
| Philosophers - Spino..> | 2013-07-04 14:43 | - | |
| Multitudes Web - Mul..> | 2013-07-04 14:43 | - | |
| Multitudes Web - Emp..> | 2013-07-04 14:43 | - | |
| INFINITE_files/ | 2013-07-04 14:43 | - | |
| Ethics, Part 1_files/ | 2013-07-04 14:43 | - | |
| De Rerum Natura text..> | 2013-07-04 14:43 | - | |
| Chapter 3_files/ | 2013-07-04 14:43 | - | |
| Beyond Good and Evil..> | 2013-07-04 14:43 | - | |
| A Theory of Spatial ..> | 2013-07-04 14:43 | - | |
| Multitudes Web - The..> | 2013-07-04 14:43 | - | |
| Multitudes Web - Néc..> | 2013-07-04 14:43 | - | |
| Multitudes Web - Mul..> | 2013-07-04 14:43 | - | |
| Johan de Witt_files/ | 2013-07-04 14:43 | - | |
| Gilles Deleuze [Inte..> | 2013-07-04 14:43 | - | |
| Chapter 5_files/ | 2013-07-04 14:43 | - | |
| 20th WCP Are Spinozi..> | 2013-07-04 14:43 | - | |
| Wolf's Introduction ..> | 2013-07-04 14:43 | - | |
| Studia Spinoziana_fi..> | 2013-07-04 14:43 | - | |
| Panentheismgfv_files/ | 2013-07-04 14:43 | - | |
| Multitudes Web - Spi..> | 2013-07-04 14:43 | - | |
| Multitudes Web - Pré..> | 2013-07-04 14:43 | - | |
| Multitudes Web - Gen..> | 2013-07-04 14:43 | - | |
| DELEUZE SPINOZA 24-0..> | 2013-07-04 14:43 | - | |
| Chapter 6_files/ | 2013-07-04 14:43 | - | |
| CATHOLIC ENCYCLOPEDI..> | 2013-07-04 14:43 | - | |
| Benedict Spinoza3_fi..> | 2013-07-04 14:43 | - | |
| Multitudes Web - L'é..> | 2013-07-04 14:43 | - | |
| Epicurus_info E-Tex..> | 2013-07-04 14:43 | - | |
| De Rerum Natura text..> | 2013-07-04 14:43 | - | |
| Balibar and Negri_fi..> | 2013-07-04 14:43 | - | |
| Affective States_files/ | 2013-07-04 14:43 | - | |
| 4_ SPINOZA'S SEMANTI..> | 2013-07-04 14:43 | - | |
| Mathematische Theolo..> | 2013-07-04 14:43 | - | |
| Multitudes Web - Pré..> | 2013-07-04 14:43 | - | |
| Toni Negri in perspe..> | 2013-07-04 14:43 | - | |
| Short Treatise on G-..> | 2013-07-04 14:43 | - | |
| Rabbi Moses Cordover..> | 2013-07-04 14:43 | - | |
| Multitudes Web - Ste..> | 2013-07-04 14:43 | - | |
| Multitudes Web - Neg..> | 2013-07-04 14:43 | - | |
| Multitudes Web - Mul..> | 2013-07-04 14:43 | - | |
| Multitudes Web - Mul..> | 2013-07-04 14:43 | - | |
| Multitudes Web - Mul..> | 2013-07-04 14:43 | - | |
| Multitudes Web - Hai..> | 2013-07-04 14:43 | - | |
| Lucretius De Rerum N..> | 2013-07-04 14:43 | - | |
| Lucretius De Rerum N..> | 2013-07-04 14:43 | - | |
| Foucault - Short Fou..> | 2013-07-04 14:43 | - | |
| Epicurus_info E-Tex..> | 2013-07-04 14:43 | - | |
| De Rerum Natura text..> | 2013-07-04 14:43 | - | |
| DELEUZE_files/ | 2013-07-04 14:43 | - | |
| The Materialist Rati..> | 2013-07-04 14:43 | - | |
| Stratégies possibles..> | 2013-07-04 14:43 | - | |
| Philosophy and the I..> | 2013-07-04 14:43 | - | |
| Multitudes Web - Les..> | 2013-07-04 14:43 | - | |
| Fr_ Seamus Mulhollan..> | 2013-07-04 14:43 | - | |
| Foucault - Historica..> | 2013-07-04 14:43 | - | |
| Epicurus_info E-Tex..> | 2013-07-04 14:43 | - | |
| DELEUZE SPINOZA 20-0..> | 2013-07-04 14:43 | - | |
| Chapter 4_files/ | 2013-07-04 14:43 | - | |
| Epicurus_info E-Tex..> | 2013-07-04 14:43 | - | |
| The idea of a Christ..> | 2013-07-04 14:43 | - | |
| Spinoza's Excommunic..> | 2013-07-04 14:43 | - | |
| Spinoza's A Politica..> | 2013-07-04 14:43 | - | |
| The Feeling of What ..> | 2013-07-04 14:43 | - | |
| Spinoza's emotions_f..> | 2013-07-04 14:43 | - | |
| SPINOZA, Benedictus ..> | 2013-07-04 14:43 | - | |
| Multitudes Web - Mul..> | 2013-07-04 14:43 | - | |
| Multitudes Web - L'e..> | 2013-07-04 14:43 | - | |
| DELEUZE SPINOZA 17-0..> | 2013-07-04 14:43 | - | |
| gilles deleuze revie..> | 2013-07-04 14:42 | - | |
| b o r d e r l a n d ..> | 2013-07-04 14:42 | - | |
| Rhizome_files/ | 2013-07-04 14:42 | - | |
| Multitudes Web - Mul..> | 2013-07-04 14:42 | - | |
| Multitudes Web - A m..> | 2013-07-04 14:42 | - | |
| Epicurus_info E-Tex..> | 2013-07-04 14:42 | - | |
| CATHOLIC ENCYCLOPEDI..> | 2013-07-04 14:42 | - | |
| WildFaith - Panenthe..> | 2013-07-04 14:42 | - | |
| Uncovering Clues to ..> | 2013-07-04 14:42 | - | |
| UC Davis Philosophy ..> | 2013-07-04 14:42 | - | |
| The vertigo of philo..> | 2013-07-04 14:42 | - | |
| Spinozistic Glossary..> | 2013-07-04 14:42 | - | |
| Notes about immortal..> | 2013-07-04 14:42 | - | |
| Necessity and contin..> | 2013-07-04 14:42 | - | |
| Multitudes Web - Tem..> | 2013-07-04 14:42 | - | |
| Multitudes Web - Lab..> | 2013-07-04 14:42 | - | |
| Lucretius De Rerum N..> | 2013-07-04 14:42 | - | |
| Infinite Modes and F..> | 2013-07-04 14:42 | - | |
| HyperSpinozag_files/ | 2013-07-04 14:42 | - | |
| CATHOLIC ENCYCLOPEDI..> | 2013-07-04 14:42 | - | |
| Althusser On Aleator..> | 2013-07-04 14:42 | - | |
| Adventures in Philos..> | 2013-07-04 14:42 | - | |
| 20th WCP The Emergen..> | 2013-07-04 14:42 | - | |
| Reading Spinoza - St..> | 2013-07-04 14:42 | - | |
| Nature Reviews Neuro..> | 2013-07-04 14:42 | - | |
| Multitudes Web - Int..> | 2013-07-04 14:42 | - | |
| Goethe - Goethe And ..> | 2013-07-04 14:42 | - | |
| Gilles Deleuze and F..> | 2013-07-04 14:42 | - | |
| Franciscus van den E..> | 2013-07-04 14:42 | - | |
| De Rerum Natura text..> | 2013-07-04 14:42 | - | |
| Chapter 2_files/ | 2013-07-04 14:42 | - | |
| Benedict De Spinoza ..> | 2013-07-04 14:42 | - | |
| An Althusserian Lexi..> | 2013-07-04 14:42 | - | |
| All 5 entries tagged..> | 2013-07-04 14:42 | - | |
| The Economism-Humani..> | 2013-07-04 14:42 | - | |
| T H E A T R U M P H ..> | 2013-07-04 14:42 | - | |
| Nicolas of Cusa and ..> | 2013-07-04 14:42 | - | |
| New Statesman - Read..> | 2013-07-04 14:42 | - | |
| Multitudes Web - A p..> | 2013-07-04 14:42 | - | |
| Epicurus_info E-Tex..> | 2013-07-04 14:42 | - | |
| De Rerum Natura text..> | 2013-07-04 14:42 | - | |
| A TREATISE ON GOD AS..> | 2013-07-04 14:42 | - | |
| The Philosophy of Ni..> | 2013-07-04 14:42 | - | |
| Spinoza' Ethics_files/ | 2013-07-04 14:42 | - | |
| Multitudes Web - L'é..> | 2013-07-04 14:42 | - | |
| Ethica/ | 2013-07-04 14:42 | - | |
| Multitudes Web - Tho..> | 2013-07-04 14:42 | - | |
| Epicurus_info E-Tex..> | 2013-07-04 14:42 | - | |
| 20th WCP Hobbes, Con..> | 2013-07-04 14:42 | - | |
| immanence - Encyclop..> | 2013-07-04 14:42 | - | |
| Tempus Spinozanum_fi..> | 2013-07-04 14:42 | - | |
| PANENTHEISM VS_ PANT..> | 2013-07-04 14:42 | - | |
| On Being and Essence..> | 2013-07-04 14:42 | - | |
| Multitudes Web - Min..> | 2013-07-04 14:42 | - | |
| Epicurus_info E-Tex..> | 2013-07-04 14:42 | - | |
| Epicurean History_fi..> | 2013-07-04 14:42 | - | |
| Beate Ringwelski Foc..> | 2013-07-04 14:42 | - | |
| Ü b e r d i e L ..> | 2013-07-04 14:42 | - | |
![[TXT]](/icons/text.gif) | Spinoza's Approach t..> | 2010-06-23 20:13 | 15K | |
| Spinoza's Metaphysic..> | 2010-06-23 20:09 | 14K | |
| Spinoza's House in R..> | 2010-06-23 20:09 | 2.0K | |
| Portraits of Spinoza..> | 2010-06-23 20:09 | 2.4K | |
| Influences.htm | 2010-06-23 20:09 | 4.8K | |
| From Bondage to Free..> | 2010-06-23 20:09 | 58K | |
| Radical Philosophy -..> | 2010-06-23 20:05 | 32K | |
| Rabbi Moses Cordover..> | 2010-06-23 20:05 | 15K | |
| Questions on divine ..> | 2010-06-23 20:05 | 27K | |
| Questions on divine ..> | 2010-06-23 20:05 | 40K | |
| Psyche 6(8) Review o..> | 2010-06-23 20:05 | 45K | |
| PSPS90.htm | 2010-06-23 20:05 | 597K | |
| Projekte - Spinoza_ ..> | 2010-06-23 20:05 | 26K | |
| Précis of The Brain ..> | 2010-06-23 20:05 | 144K | |
| Pragmatic-Machinic.htm | 2010-06-23 20:05 | 118K | |
| POWER AND DESIRE IN ..> | 2010-06-23 20:05 | 80K | |
| Posthegemony Februar..> | 2010-06-23 20:05 | 146K | |
| Politics and History..> | 2010-06-23 20:05 | 434K | |
| plane of immanence.htm | 2010-06-23 20:05 | 9.1K | |
| Politics After Spino..> | 2010-06-23 20:05 | 50K | |
| Plateau 11_ 1837 Of ..> | 2010-06-23 20:05 | 40K | |
| Plane of immanence -..> | 2010-06-23 20:05 | 26K | |
| Philosophy and the I..> | 2010-06-23 20:05 | 109K | |
| Philosophers - Spino..> | 2010-06-23 20:05 | 407K | |
| pantheismf.htm | 2010-06-23 20:05 | 124K | |
| Parallelism and the ..> | 2010-06-23 20:05 | 34K | |
| PHI 600 Levinas and ..> | 2010-06-23 20:05 | 7.5K | |
| pantheism.htm | 2010-06-23 20:04 | 124K | |
| Pantheism - Wikipedi..> | 2010-06-23 20:04 | 82K | |
| Panentheismgfv.htm | 2010-06-23 20:04 | 13K | |
| Panentheismf.htm | 2010-06-23 20:04 | 12K | |
| Panentheism.htm | 2010-06-23 20:04 | 10K | |
| Paintings.htm | 2010-06-23 20:04 | 8.3K | |
| Pain Processes - 2.htm | 2010-06-23 20:04 | 30K | |
| Pain Processes - 1.htm | 2010-06-23 20:04 | 30K | |
| PANENTHEISM VS_ PANT..> | 2010-06-23 20:04 | 10K | |
| Or Hashem - Wikipedi..> | 2010-06-23 20:04 | 27K | |
| On the Improvement o..> | 2010-06-23 20:04 | 81K | |
| On the Imagination.htm | 2010-06-23 20:04 | 158K | |
| notesb.htm | 2010-06-23 20:04 | 22K | |
| On the Fittingness o..> | 2010-06-23 20:04 | 6.6K | |
| On Jacobi's Letters ..> | 2010-06-23 20:04 | 22K | |
| On Being and Essence..> | 2010-06-23 20:04 | 6.2K | |
| Notes on Materialism..> | 2010-06-23 20:04 | 7.9K | |
| Notes.htm | 2010-06-23 20:04 | 1.0K | |
| nikolas von kues.htm | 2010-06-23 20:04 | 31K | |
| Notes about immortal..> | 2010-06-23 20:04 | 42K | |
| Nietzsche Genealogy ..> | 2010-06-23 20:04 | 7.0K | |
| Nicolle.htm | 2010-06-23 20:04 | 103K | |
| NIMH Depression Trac..> | 2010-06-23 20:04 | 14K | |
| Nicolas of Cusa and ..> | 2010-06-23 20:04 | 69K | |
| Nicholas of Cusa - W..> | 2010-06-23 20:04 | 27K | |
| New Statesman - Read..> | 2010-06-23 20:04 | 23K | |
| New Page 2.htm | 2010-06-23 20:04 | 352K | |
| negriantimod.htm | 2010-06-23 20:04 | 25K | |
| New approaches to an..> | 2010-06-23 20:04 | 239K | |
| Neurons.htm | 2010-06-23 20:04 | 8.0K | |
| Necessity and contin..> | 2010-06-23 20:04 | 44K | |
| Nature Reviews Neuro..> | 2010-06-23 20:04 | 777 | |
| Naturalistic panthei..> | 2010-06-23 20:04 | 29K | |
| Multitudes Web - Tho..> | 2010-06-23 20:04 | 18K | |
| Multitudes Web - The..> | 2010-06-23 20:04 | 21K | |
| Multitudes Web - Tem..> | 2010-06-23 20:04 | 54K | |
| Multitudes Web - Ste..> | 2010-06-23 20:04 | 19K | |
| Multitudes Web - Spi..> | 2010-06-23 20:04 | 48K | |
| Multitudes Web - Pré..> | 2010-06-23 20:04 | 48K | |
| Multitudes Web - Pré..> | 2010-06-23 20:04 | 21K | |
| Multitudes Web - Pré..> | 2010-06-23 20:04 | 17K | |
| Multitudes Web - Neg..> | 2010-06-23 20:04 | 35K | |
| Multitudes Web - Néc..> | 2010-06-23 20:04 | 80K | |
| Multitudes Web - Mul..> | 2010-06-23 20:04 | 7.5K | |
| Multitudes Web - Mul..> | 2010-06-23 20:04 | 17K | |
| Multitudes Web - Mul..> | 2010-06-23 20:04 | 16K | |
| Multitudes Web - Mul..> | 2010-06-23 20:04 | 21K | |
| Multitudes Web - Mul..> | 2010-06-23 20:04 | 22K | |
| Multitudes Web - Mul..> | 2010-06-23 20:04 | 21K | |
| Multitudes Web - Mul..> | 2010-06-23 20:04 | 19K | |
| Multitudes Web - Mul..> | 2010-06-23 20:04 | 20K | |
| Multitudes Web - Mul..> | 2010-06-23 20:04 | 36K | |
| Multitudes Web - Min..> | 2010-06-23 20:04 | 6.3K | |
| Multitudes Web - Mar..> | 2010-06-23 20:04 | 21K | |
| Multitudes Web - Les..> | 2010-06-23 20:04 | 19K | |
| Multitudes Web - Lab..> | 2010-06-23 20:04 | 36K | |
| Multitudes Web - L'é..> | 2010-06-23 20:04 | 19K | |
| Multitudes Web - L'e..> | 2010-06-23 20:04 | 44K | |
| Multitudes Web - L'é..> | 2010-06-23 20:04 | 19K | |
| Multitudes Web - Int..> | 2010-06-23 20:04 | 10K | |
| Multitudes Web - Hai..> | 2010-06-23 20:04 | 15K | |
| Multitudes Web - Gen..> | 2010-06-23 20:04 | 40K | |
| Multitudes Web - Emp..> | 2010-06-23 20:04 | 17K | |
| Multitudes Web - A p..> | 2010-06-23 20:04 | 81K | |
| Multitudes Web - A m..> | 2010-06-23 20:04 | 29K | |
| Multitudes Web - « R..> | 2010-06-23 20:04 | 47K | |
| Multitudes Web - « A..> | 2010-06-23 20:04 | 28K | |
| mp6.htm | 2010-06-23 20:04 | 18K | |
| Modern History Sourc..> | 2010-06-23 20:04 | 3.7K | |
| Modern History Sourc..> | 2010-06-23 20:04 | 91K | |
| Meyers Konversations..> | 2010-06-23 20:04 | 16K | |
| Metaphysical Sources..> | 2010-06-23 20:04 | 31K | |
| Mauthner; Spinoza.htm | 2010-06-23 20:04 | 163K | |
| Matheron.htm | 2010-06-23 20:04 | 11K | |
| Mathematische Theolo..> | 2010-06-23 20:04 | 55K | |
| Martin Heidegger - N..> | 2010-06-23 20:03 | 38K | |
| Marco Iacoboni.htm | 2010-06-23 20:03 | 13K | |
| Maps.htm | 2010-06-23 20:03 | 5.0K | |
![[IMG]](/icons/image2.gif) | Map-1579_Union_of_Ut..> | 2010-06-23 20:03 | 173K | |
| malebranche.htm | 2010-06-23 20:03 | 56K | |
| Map-1477_Low_Countri..> | 2010-06-23 20:03 | 142K | |
| maimspin.htm | 2010-06-23 20:03 | 277K | |
| lucretius.htm | 2010-06-23 20:03 | 54K | |
| Lucretius De Rerum N..> | 2010-06-23 20:03 | 64K | |
| Lucretius De Rerum N..> | 2010-06-23 20:03 | 71K | |
| Lucretius De Rerum N..> | 2010-06-23 20:03 | 65K | |
| Lucretius De Rerum N..> | 2010-06-23 20:03 | 55K | |
| Lucretius De Rerum N..> | 2010-06-23 20:03 | 87K | |
| Lucretius De Rerum N..> | 2010-06-23 20:03 | 82K | |
| Lucretius [Internet ..> | 2010-06-23 20:03 | 61K | |
| Louis Althusser - Wi..> | 2010-06-23 20:03 | 98K | |
| Limbic System.htm | 2010-06-23 20:03 | 31K | |
| Limbic System The Ce..> | 2010-06-23 20:03 | 32K | |
| Lichtenstein Creativ..> | 2010-06-23 20:03 | 13K | |
| Leo_belgicus.png | 2010-06-23 20:03 | 372K | |
| Lenin and Philosophy..> | 2010-06-23 20:02 | 252K | |
| Leibnizs moral philo..> | 2010-06-23 20:02 | 69K | |
| LD5Spinoza.htm | 2010-06-23 20:02 | 32K | |
| La critique de la re..> | 2010-06-23 20:02 | 678K | |
| LD3Hobbes.htm | 2010-06-23 20:02 | 23K | |
| korotonomedya Anton..> | 2010-06-23 20:02 | 53K | |
| Koninkrijk_der_Neder..> | 2010-06-23 20:02 | 400K | |
| Kolakowski On Spinoz..> | 2010-06-23 20:02 | 4.6K | |
| kissingerspinoza.htm | 2010-06-23 20:02 | 269K | |
| Knowledge and Immort..> | 2010-06-23 20:02 | 35K | |
| Kiss Endre Von Spino..> | 2010-06-23 20:02 | 138K | |
| Kiss Endre SPINOZA V..> | 2010-06-23 20:02 | 41K | |
| John Duns Scotus.htm | 2010-06-23 20:02 | 248K | |
| Johan de Witt.htm | 2010-06-23 20:02 | 13K | |
| JDS, II_3_1_5-6.htm | 2010-06-23 20:02 | 58K | |
| invParallel6.png | 2010-06-23 20:02 | 25K | |
| image003.png | 2010-06-23 20:02 | 12K | |
| ideen21total6ml.png | 2010-06-23 20:02 | 17K | |
| ideen21implicite3sz.png | 2010-06-23 20:02 | 6.9K | |
| IssueI208c.htm | 2010-06-23 20:02 | 27K | |
| ideen21data9wy.png | 2010-06-23 20:02 | 5.1K | |
| ideen21cogitatiocogi..> | 2010-06-23 20:02 | 3.3K | |
| Id-map.png | 2010-06-23 20:02 | 23K | |
| Iberian_Union_Empire..> | 2010-06-23 20:02 | 38K | |
| Golden_Rectangle_Con..> | 2010-06-23 20:02 | 14K | |
| Goethe01.png | 2010-06-23 20:02 | 41K | |
| GNOME-AmanitaMuscari..> | 2010-06-23 20:02 | 1.1M | |
| Gallileo_Inquisition..> | 2010-06-23 20:02 | 109K | |
| floral6Ring.png | 2010-06-23 20:02 | 66K | |
| floral5Ring.png | 2010-06-23 20:02 | 24K | |
| FakeRealLogSpiral.png | 2010-06-23 20:02 | 4.7K | |
| European_settlements..> | 2010-06-23 20:02 | 214K | |
| EU_location_NED.png | 2010-06-23 20:02 | 526K | |
| emotion.png | 2010-06-23 20:02 | 205K | |
| Dutch-Empire-coloure..> | 2010-06-23 20:02 | 21K | |
| Dualism.png | 2010-06-23 20:02 | 5.7K | |
| Drug_SSRI_2.png | 2010-06-23 20:02 | 564K | |
| diagram3.png | 2010-06-23 20:02 | 53K | |
| brain_surg_OCD.png | 2010-06-23 20:02 | 420K | |
| brain_struc_DPN.png | 2010-06-23 20:02 | 283K | |
| Benelux_satellite_im..> | 2010-06-23 20:02 | 900K | |
| beatitudo.png | 2010-06-23 20:02 | 16K | |
| Antoni_van_Leeuwenho..> | 2010-06-23 20:02 | 255K | |
| 800px-Fibonacci_spir..> | 2010-06-23 20:02 | 17K | |
| 627px-Medieval_manus..> | 2010-06-23 20:02 | 17K | |
| 506px-Religion_Nethe..> | 2010-06-23 20:02 | 123K | |
| 475px-Golden_Rectang..> | 2010-06-23 20:02 | 25K | |
| 400px-Maslow's_hiera..> | 2010-06-23 20:02 | 71K | |
| 400px-Dualism.png | 2010-06-23 20:02 | 24K | |
| 352px-Square_of_Oppo..> | 2010-06-23 20:02 | 33K | |
| spint10/ | 2010-06-23 19:48 | - | |
| Plane of immanence -..> | 2010-06-23 19:48 | - | |
| Pantheism - Wikipedi..> | 2010-06-23 19:48 | - | |
| Or Hashem - Wikipedi..> | 2010-06-23 19:48 | - | |
| Nicholas of Cusa - W..> | 2010-06-23 19:48 | - | |
| Naturalistic panthei..> | 2010-06-23 19:48 | - | |
| Maimonides/ | 2010-06-23 19:47 | - | |
| Inner Life of a Cell/ | 2010-06-23 19:46 | - | |
| Immanence - Wikipedi..> | 2010-06-23 19:46 | - | |
| Histoire de la philo..> | 2010-06-23 19:44 | - | |
| Gilles Deleuze - Wik..> | 2010-06-23 19:44 | - | |
| Duns Scotus - Wikipe..> | 2010-06-23 19:41 | - | |
| Conatus - Wikipedia,..> | 2010-06-23 19:41 | - | |
| Baruch Spinoza - Lov..> | 2010-06-23 19:40 | - | |
| Antonio Negri - Wiki..> | 2010-06-23 19:40 | - | |
| Emerald Viewer.app/ | 2010-06-22 14:34 | - | |
| UMB/ | 2010-06-16 14:56 | - | |
| Struggles Within the..> | 2010-06-16 14:55 | 4.0K | |
| Spinoza/ | 2010-06-16 14:53 | - | |
| Sources.html | 2010-06-16 14:52 | 142K | |
![[ ]](/icons/unknown.gif) | Sources of Spinoza's..> | 2010-06-16 14:52 | 6.9M | |
| Secondary Sources.html | 2010-06-16 14:52 | 24K | |
| Radical Spinoza.htm | 2010-06-16 14:52 | 26K | |
| Amsterdam.htm | 2010-06-16 14:52 | 3.5K | |
| History as a Process..> | 2010-06-16 14:45 | 1.0K | |
| History as a Process..> | 2010-06-16 14:45 | 1.0K | |
| Histoire de la philo..> | 2010-06-16 14:45 | 117K | |
| Hegel's History of P..> | 2010-06-16 14:45 | 84K | |
| Hegel on Religion an..> | 2010-06-16 14:45 | 404K | |
| Head Robot Team.htm | 2010-06-16 14:45 | 40K | |
| Grammar of the Multi..> | 2010-06-16 14:45 | 286K | |
| Goethean Science IV ..> | 2010-06-16 14:45 | 125K | |
| Goethe - Goethe And ..> | 2010-06-16 14:45 | 19K | |
| GODASFIR.htm | 2010-06-16 14:45 | 226K | |
| God and Creativity A..> | 2010-06-16 14:45 | 248K | |
| Glossary.htm | 2010-06-16 14:45 | 229K | |
| Glossary terms New ..> | 2010-06-16 14:45 | 14K | |
| gilles deleuze revie..> | 2010-06-16 14:45 | 16K | |
| Gilles Deleuze and F..> | 2010-06-16 14:45 | 39K | |
| Gilles Deleuze [Inte..> | 2010-06-16 14:45 | 145K | |
| Gilles Deleuze - Wik..> | 2010-06-16 14:45 | 108K | |
| gersonides.htm | 2010-06-16 14:45 | 51K | |
| Full Record -- Conte..> | 2010-06-16 14:45 | 6.7K | |
| Franciscus van den E..> | 2010-06-16 14:45 | 3.1K | |
| Franciscus van den E..> | 2010-06-16 14:45 | 3.1K | |
| Fr_ Seamus Mulhollan..> | 2010-06-16 14:45 | 23K | |
| Foucault - Short Fou..> | 2010-06-16 14:45 | 15K | |
| Foucault - Order of ..> | 2010-06-16 14:45 | 23K | |
| Foucault - Order of ..> | 2010-06-16 14:45 | 22K | |
| Foucault - Historica..> | 2010-06-16 14:45 | 11K | |
| Foucault - Foucault ..> | 2010-06-16 14:45 | 33K | |
| Foucault - Chronolog..> | 2010-06-16 14:45 | 4.5K | |
| Exodus.html | 2010-06-16 14:45 | 5.9K | |
| Ethics, Part 1.htm | 2010-06-16 14:45 | 126K | |
| Ethics as Post-Polit..> | 2010-06-16 14:45 | 53K | |
| Ethics - Scholia2.htm | 2010-06-16 14:45 | 310K | |
| Ethics - Scholia.htm | 2010-06-16 14:45 | 455K | |
| Eternity of the m.htm | 2010-06-16 14:45 | 110K | |
| ESC76.htm | 2010-06-16 14:45 | 544K | |
| Epicurus_info E-Tex..> | 2010-06-16 14:45 | 204K | |
| Epicurus_info E-Tex..> | 2010-06-16 14:45 | 88K | |
| Epicurus_info E-Tex..> | 2010-06-16 14:45 | 13K | |
| Epicurus_info E-Tex..> | 2010-06-16 14:45 | 99K | |
| Epicurus_info E-Tex..> | 2010-06-16 14:45 | 779K | |
| Epicurus_info E-Tex..> | 2010-06-16 14:45 | 88K | |
| Epicurus_info E-Tex..> | 2010-06-16 14:45 | 134K | |
| Epicurus_info E-Tex..> | 2010-06-16 14:45 | 100K | |
| Epicurus_info E-Tex..> | 2010-06-16 14:45 | 97K | |
| Epicurus_info E-Tex..> | 2010-06-16 14:45 | 101K | |
| Epicurus_info E-Tex..> | 2010-06-16 14:45 | 113K | |
| Epicurus_info E-Tex..> | 2010-06-16 14:45 | 28K | |
| Epicurus_info E-Tex..> | 2010-06-16 14:45 | 67K | |
| Epicurus_info E-Tex..> | 2010-06-16 14:45 | 349K | |
| Epicurean History.htm | 2010-06-16 14:45 | 71K | |
| empireruptures.htm | 2010-06-16 14:45 | 30K | |
| Entrez PubMed.htm | 2010-06-16 14:45 | 52K | |
| empiremultitude.htm | 2010-06-16 14:45 | 61K | |
| Emotional Processing..> | 2010-06-16 14:45 | 18K | |
| Emotion 2.htm | 2010-06-16 14:45 | 17K | |
| Emotion - Wikipedia,..> | 2010-06-16 14:45 | 91K | |
| Elwes's Introduction..> | 2010-06-16 14:45 | 1.0M | |
| Einstein-Spinoza.htm | 2010-06-16 14:45 | 24K | |
| EckTractXVI.htm | 2010-06-16 14:45 | 4.5K | |
| EckTractXIX.htm | 2010-06-16 14:45 | 22K | |
| EckTractXIV.htm | 2010-06-16 14:45 | 25K | |
| EckTractXII.htm | 2010-06-16 14:45 | 14K | |
| EckTractX.htm | 2010-06-16 14:45 | 11K | |
| EckTractVII.htm | 2010-06-16 14:45 | 9.9K | |
| EckSermxxvi.htm | 2010-06-16 14:45 | 8.4K | |
| EckSermXXXIV.htm | 2010-06-16 14:45 | 6.0K | |
| EckSermXXVII.htm | 2010-06-16 14:45 | 5.6K | |
| EckSermXXIX.htm | 2010-06-16 14:45 | 5.7K | |
| EckSermxvii.htm | 2010-06-16 14:44 | 5.7K | |
| EckSermXXIV.htm | 2010-06-16 14:44 | 6.8K | |
| EckSermXVI.htm | 2010-06-16 14:44 | 5.9K | |
| EckSermXV.htm | 2010-06-16 14:44 | 10K | |
| EckSermXLVI.htm | 2010-06-16 14:44 | 6.9K | |
| EckSermxciv.htm | 2010-06-16 14:44 | 10K | |
| EckSermXII.htm | 2010-06-16 14:44 | 13K | |
| EckSermXCIII.htm | 2010-06-16 14:44 | 5.8K | |
| EckSermXCII.htm | 2010-06-16 14:44 | 6.4K | |
| EckSermlxxxi.htm | 2010-06-16 14:44 | 9.2K | |
| EckSermX.htm | 2010-06-16 14:44 | 7.2K | |
| EckSermLXXXII.htm | 2010-06-16 14:44 | 9.2K | |
| EckSermLXXX.htm | 2010-06-16 14:44 | 7.9K | |
| EckSermLXXVIII.htm | 2010-06-16 14:44 | 6.6K | |
| EckSermlxxi.htm | 2010-06-16 14:44 | 4.5K | |
| EckSermLXXVII.htm | 2010-06-16 14:44 | 6.2K | |
| EckSermLXX.htm | 2010-06-16 14:44 | 3.7K | |
| EckSermLXII.htm | 2010-06-16 14:44 | 5.9K | |
| EckSermLXI.htm | 2010-06-16 14:44 | 5.7K | |
| EckSermLVI.htm | 2010-06-16 14:44 | 14K | |
| EckSermLIV.htm | 2010-06-16 14:44 | 7.6K | |
| EckSermLIII.htm | 2010-06-16 14:44 | 5.3K | |
| EckSermIX.htm | 2010-06-16 14:44 | 5.0K | |
| eckhart.htm | 2010-06-16 14:44 | 9.6K | |
| EckSermII.htm | 2010-06-16 14:44 | 15K | |
| EckSermI.htm | 2010-06-16 14:44 | 22K | |
| EckSemxviii.htm | 2010-06-16 14:44 | 6.2K | |
| EckLastWord.htm | 2010-06-16 14:44 | 5.6K | |
| E&S note emotions- D..> | 2010-06-16 14:44 | 9.9K | |
| Dutch Wars of Libera..> | 2010-06-16 14:44 | 5.3K | |
| Dutch Revolt - Wikip..> | 2010-06-16 14:44 | 137K | |
| Dutch Politics.htm | 2010-06-16 14:44 | 6.0K | |
| Dutch East India Com..> | 2010-06-16 14:44 | 83K | |
| Dutch Capitalism.htm | 2010-06-16 14:44 | 12K | |
| durst.htm | 2010-06-16 14:44 | 438K | |
| duns-scotus.htm | 2010-06-16 14:44 | 69K | |
| Duns Scotus - Wikipe..> | 2010-06-16 14:44 | 48K | |
| Du matérialisme de S..> | 2010-06-16 14:44 | 68K | |
| dorato-faye (L&PS - ..> | 2010-06-16 14:44 | 98K | |
| Dog Food Recipes + C..> | 2010-06-16 14:44 | 246K | |
| Doctrines of Meister..> | 2010-06-16 14:44 | 46K | |
| Divine Immanence.htm | 2010-06-16 14:44 | 45K | |
| Differential and Ple..> | 2010-06-16 14:44 | 1.0K | |
| Wolf's Introduction ..> | 2010-06-16 14:44 | 439K | |
| WildFaith - Panenthe..> | 2010-06-16 14:44 | 22K | |
| Week 11 Medieval ele..> | 2010-06-16 14:44 | 37K | |
| Week 2 Scotus's proo..> | 2010-06-16 14:44 | 38K | |
| WAW Moll Antonie van..> | 2010-06-16 14:44 | 279K | |
| W24A5.htm | 2010-06-16 14:44 | 69K | |
| Vili Kingdom of Loan..> | 2010-06-16 14:44 | 13K | |
| Value and affect - N..> | 2010-06-16 14:44 | 45K | |
| universals-medieval.htm | 2010-06-16 14:44 | 133K | |
| Untitled Document.htm | 2010-06-16 14:44 | 111K | |
| Uncovering Clues to ..> | 2010-06-16 14:44 | 23K | |
| UC Davis Philosophy ..> | 2010-06-16 14:44 | 42K | |
| Übermensch - Wikiped..> | 2010-06-16 14:44 | 67K | |
| Ü b e r d i e L ..> | 2010-06-16 14:44 | 84K | |
| tronti_refusal.html | 2010-06-16 14:44 | 59K | |
| tradicalmachines.htm | 2010-06-16 14:44 | 22K | |
| Tractatus Politicus.htm | 2010-06-16 14:44 | 217K | |
| TPTch13.htm | 2010-06-16 14:44 | 21K | |
| TPTch12.htm | 2010-06-16 14:44 | 32K | |
| TPTch11.htm | 2010-06-16 14:44 | 27K | |
| TPTch10.htm | 2010-06-16 14:44 | 37K | |
| TPTch9.htm | 2010-06-16 14:44 | 48K | |
| TPTch_8.htm | 2010-06-16 14:44 | 46K | |
| TPTch_7.htm | 2010-06-16 14:44 | 46K | |
| TPTch5.htm | 2010-06-16 14:44 | 45K | |
| Spinoza-TractatusPol..> | 2010-06-16 14:44 | 216K | |
![[ ]](/icons/layout.gif) | Some of Malebranche'..> | 2010-06-16 14:44 | 228K | |
| Some Incoherencies i..> | 2010-06-16 14:44 | 561K | |
| Some Incoherencies i..> | 2010-06-16 14:44 | 570K | |
| Some Guiding Princip..> | 2010-06-16 14:44 | 255K | |
| Some Considerations ..> | 2010-06-16 14:44 | 400K | |
| Simple Wholes and Co..> | 2010-06-16 14:44 | 241K | |
| sermons.pdf | 2010-06-16 14:44 | 117K | |
| Self-Deceptive Emoti..> | 2010-06-16 14:44 | 635K | |
| SCOTUS.Ord2d3p2q5-6...> | 2010-06-16 14:44 | 163K | |
| SCOTUS.Ord2d3p2q4.tr..> | 2010-06-16 14:44 | 147K | |
| SCOTUS.Ord2d3p2q3.tr..> | 2010-06-16 14:44 | 69K | |
| SCOTUS.Ord2d3p2q2.tr..> | 2010-06-16 14:44 | 89K | |
| Scotus_on_Singular_E..> | 2010-06-16 14:44 | 248K | |
| SCOTUS.Ord2d3p2q1.tr..> | 2010-06-16 14:44 | 124K | |
| Scotus_on_Self-Chang..> | 2010-06-16 14:44 | 439K | |
| Scotus_on_Metaphysic..> | 2010-06-16 14:44 | 307K | |
| Scotus_on_Mental_Con..> | 2010-06-16 14:44 | 210K | |
| Scotus_on_Common_Nat..> | 2010-06-16 14:44 | 210K | |
| Schleiermacher's Pos..> | 2010-06-16 14:44 | 661K | |
| Sartre's Theory of t..> | 2010-06-16 14:44 | 185K | |
| SC73.pdf | 2010-06-16 14:44 | 54K | |
| Saint Bonaventure, F..> | 2010-06-16 14:44 | 126K | |
| Rousseau and Spinoza..> | 2010-06-16 14:44 | 930K | |
| roffe_spinoza_infini..> | 2010-06-16 14:43 | 102K | |
| Roots.pdf | 2010-06-16 14:43 | 50K | |
| Repeating the Rhizom..> | 2010-06-16 14:43 | 277K | |
| Remarks on Spinoza's..> | 2010-06-16 14:43 | 220K | |
| Reflexivity and Emot..> | 2010-06-16 14:43 | 260K | |
| Reconstructing McTag..> | 2010-06-16 14:43 | 80K | |
| Reconciling Cognitiv..> | 2010-06-16 14:43 | 481K | |
| Rationality and the ..> | 2010-06-16 14:43 | 260K | |
| Prof. Hallett's Aete..> | 2010-06-16 14:43 | 420K | |
| Prof. Hallet's Aeter..> | 2010-06-16 14:43 | 454K | |
| powerchart.pdf | 2010-06-16 14:43 | 16K | |
| Preface-Cusa-Reader.pdf | 2010-06-16 14:43 | 28K | |
| Postscript on the So..> | 2010-06-16 14:43 | 101K | |
| Politics18.pdf | 2010-06-16 14:43 | 16K | |
| Pantheism in Spinoza..> | 2010-06-16 14:43 | 462K | |
| On Unconscious Emoti..> | 2010-06-16 14:43 | 513K | |
| On the Relation Betw..> | 2010-06-16 14:43 | 704K | |
| On the History of Sp..> | 2010-06-16 14:43 | 2.4M | |
| On the Cognitive Fun..> | 2010-06-16 14:43 | 254K | |
| On Gilles Deleuze's ..> | 2010-06-16 14:43 | 461K | |
| ockham.pdf | 2010-06-16 14:43 | 314K | |
| Omnes.pdf | 2010-06-16 14:43 | 18K | |
| Objectless Emotions.pdf | 2010-06-16 14:43 | 226K | |
| Notes on the Second ..> | 2010-06-16 14:43 | 529K | |
| Notes on the Second ..> | 2010-06-16 14:43 | 642K | |
| Notes on the Second ..> | 2010-06-16 14:43 | 553K | |
| Notes on the Philoso..> | 2010-06-16 14:43 | 645K | |
| Notes on Spinoza's C..> | 2010-06-16 14:43 | 391K | |
| nm0501_541.pdf | 2010-06-16 14:43 | 574K | |
| Nicole Oresme and th..> | 2010-06-16 14:43 | 652K | |
| Nicholas of Cusa.pdf | 2010-06-16 14:43 | 661K | |
| Nicholas of Cusa-Con..> | 2010-06-16 14:43 | 481K | |
| Nicholas of Cusa on ..> | 2010-06-16 14:43 | 335K | |
| Nicholas of Cusa and..> | 2010-06-16 14:42 | 1.2M | |
| Nicholas of Cusa and..> | 2010-06-16 14:42 | 382K | |
| Narrative Emotions.pdf | 2010-06-16 14:42 | 589K | |
| NGH.pdf | 2010-06-16 14:42 | 15K | |
| NA12-2000.pdf | 2010-06-16 14:42 | 196K | |
| Mysticism and the Co..> | 2010-06-16 14:42 | 490K | |
| Morality and the Ret..> | 2010-06-16 14:42 | 494K | |
| monologion.pdf | 2010-06-16 14:42 | 292K | |
| Mille Plateaux and t..> | 2010-06-16 14:42 | 363K | |
| Melamed.pdf | 2010-06-16 14:42 | 163K | |
| MEANING IN SPINOZA_S..> | 2010-06-16 14:42 | 231K | |
| Meaning and Feeling ..> | 2010-06-16 14:42 | 676K | |
| McTaggart's Paradox ..> | 2010-06-16 14:42 | 260K | |
| Materialism and the ..> | 2010-06-16 14:42 | 704K | |
| Manuscripts of Nicho..> | 2010-06-16 14:42 | 149K | |
| Maimonides, Spinoza,..> | 2010-06-16 14:42 | 150K | |
| Maimonides and Spino..> | 2010-06-16 14:42 | 551K | |
| Machinic Vision.pdf | 2010-06-16 14:42 | 434K | |
| Locke, Spinoza and t..> | 2010-06-16 14:42 | 58K | |
| light.pdf | 2010-06-16 14:42 | 260K | |
| Justifying the Emoti..> | 2010-06-16 14:42 | 244K | |
| Judgmental Emotions.pdf | 2010-06-16 14:42 | 320K | |
| jirs2-03.pdf | 2010-06-16 14:42 | 60K | |
| Jewish Mediaeval Phi..> | 2010-06-16 14:42 | 924K | |
| James_Spinoza.pdf | 2010-06-16 14:42 | 360K | |
| j.1747-9991.2006.000..> | 2010-06-16 14:42 | 141K | |
| Is Music the Languag..> | 2010-06-16 14:42 | 438K | |
| In Defense of Spinoz..> | 2010-06-16 14:42 | 509K | |
| Improvement_of_the_U..> | 2010-06-16 14:42 | 7.1M | |
| IMPERIUM AETERNUM.pdf | 2010-06-16 14:41 | 56K | |
| impassivity.pdf | 2010-06-16 14:41 | 132K | |
| immortality.pdf | 2010-06-16 14:41 | 133K | |
| Hume on Morality and..> | 2010-06-16 14:41 | 283K | |
| Human Emotions-Unive..> | 2010-06-16 14:41 | 262K | |
| How to Study Spinoza..> | 2010-06-16 14:41 | 1.7M | |
| How Many Emotions Ar..> | 2010-06-16 14:41 | 488K | |
| Hobbesian%20Mechanic..> | 2010-06-16 14:41 | 196K | |
| Hermann Cohen's Perc..> | 2010-06-16 14:41 | 292K | |
| Hegel, Pantheism, an..> | 2010-06-16 14:41 | 268K | |
| Grant.pdf | 2010-06-16 14:41 | 82K | |
| Governmentality.pdf | 2010-06-16 14:41 | 18K | |
| Giordano Bruno.pdf | 2010-06-16 14:41 | 761K | |
| Giordano Bruno-Neopl..> | 2010-06-16 14:41 | 634K | |
| Geschichte_der_Neuer..> | 2010-06-16 14:41 | 23M | |
| Galileo and Spinoza.pdf | 2010-06-16 14:39 | 523K | |
| Four Medieval Views ..> | 2010-06-16 14:39 | 597K | |
| Flaubert and Spinoza..> | 2010-06-16 14:39 | 551K | |
| extricating%20negri.pdf | 2010-06-16 14:39 | 163K | |
| Expressivism, Morali..> | 2010-06-16 14:39 | 462K | |
| Explaining Emotions.pdf | 2010-06-16 14:39 | 649K | |
| Existentialism, Emot..> | 2010-06-16 14:39 | 436K | |
| Evaluating the Emoti..> | 2010-06-16 14:39 | 313K | |
| Ethics without Moral..> | 2010-06-16 14:39 | 127K | |
| Ethic_Demonstrated_i..> | 2010-06-16 14:39 | 8.9M | |
| Entwicklung und Abst..> | 2010-06-16 14:38 | 406K | |
| Enlightenment.pdf | 2010-06-16 14:38 | 20K | |
| Empire.pdf | 2010-06-16 14:38 | 7.5M | |
| Emotions, Issue Impo..> | 2010-06-16 14:38 | 352K | |
| Emotions versus Plea..> | 2010-06-16 14:38 | 368K | |
| Emotions in Personal..> | 2010-06-16 14:38 | 170K | |
| Emotions in Music (A..> | 2010-06-16 14:38 | 234K | |
| Emotions and the Act..> | 2010-06-16 14:38 | 370K | |
| Emotions and Incomme..> | 2010-06-16 14:38 | 554K | |
| Emotions and Behavio..> | 2010-06-16 14:38 | 160K | |
| Elements_of_Metaphys..> | 2010-06-16 14:38 | 11M | |
| Einstein and Religio..> | 2010-06-16 14:37 | 374K | |
| eckhart.pdf | 2010-06-16 14:37 | 718K | |
| Durkheim and the Soc..> | 2010-06-16 14:37 | 250K | |
| DR5.pdf | 2010-06-16 14:37 | 37K | |
| DR4.pdf | 2010-06-16 14:37 | 112K | |
| DR3.pdf | 2010-06-16 14:37 | 118K | |
| DR2.pdf | 2010-06-16 14:37 | 150K | |
| DR1.pdf | 2010-06-16 14:37 | 128K | |
| DR.pdf | 2010-06-16 14:37 | 82K | |
| DPubS.pdf | 2010-06-16 14:37 | 2.3M | |
| donagan_s_spinoza.pdf | 2010-06-16 14:37 | 2.2M | |
| Die_Philosophie_des_..> | 2010-06-16 14:36 | 36M | |
| dialecticalmysticism..> | 2010-06-16 14:34 | 899K | |
| DI-Intro12-2000.pdf | 2010-06-16 14:34 | 220K | |
| DI-III-12-2000.pdf | 2010-06-16 14:34 | 147K | |
| DI-II-12-2000.pdf | 2010-06-16 14:34 | 156K | |
| DeVeritate.pdf | 2010-06-16 14:34 | 115K | |
| DI-I-12-2000.pdf | 2010-06-16 14:34 | 175K | |
| DeStaticis2-2000.pdf | 2010-06-16 14:34 | 217K | |
| Descartes and Modern..> | 2010-06-16 14:34 | 260K | |
| DeSap12-2000.pdf | 2010-06-16 14:34 | 105K | |
| DeQuaerendo12-2000.pdf | 2010-06-16 14:34 | 92K | |
| DePrincipio12-2000.pdf | 2010-06-16 14:34 | 121K | |
| DePossest12-2000.pdf | 2010-06-16 14:34 | 149K | |
| DePace12-2000.pdf | 2010-06-16 14:34 | 131K | |
| Democracy in Spinoza..> | 2010-06-16 14:34 | 300K | |
| DeLudo12-2000.pdf | 2010-06-16 14:34 | 289K | |
| DeGenesi12-2000.pdf | 2010-06-16 14:34 | 104K | |
| DeFiliatione12-2000.pdf | 2010-06-16 14:34 | 102K | |
| DeDeoAbscon12-2000.pdf | 2010-06-16 14:34 | 57K | |
| DeDato12-2000.pdf | 2010-06-16 14:34 | 70K | |
| Decorous Bodies and ..> | 2010-06-16 14:34 | 494K | |
| DeBeryllo12-2000.pdf | 2010-06-16 14:34 | 164K | |
| DeApice12-2000.pdf | 2010-06-16 14:34 | 87K | |
| DeAequalitate12-2000..> | 2010-06-16 14:34 | 121K | |
| Cusanus at Sea.pdf | 2010-06-16 14:34 | 527K | |
| CUSA-midwest%20studi..> | 2010-06-16 14:34 | 72K | |
| Coursagregspinoza06%..> | 2010-06-16 14:34 | 282K | |
| Copernicus' Relation..> | 2010-06-16 14:34 | 288K | |
| Compendium12-2000.pdf | 2010-06-16 14:34 | 117K | |
| Cognitivism in the T..> | 2010-06-16 14:34 | 583K | |
| Causes, Objects, and..> | 2010-06-16 14:33 | 94K | |
| Causes and Objects o..> | 2010-06-16 14:33 | 119K | |
| Causation and the Ge..> | 2010-06-16 14:33 | 564K | |
| Causation and the Ge..> | 2010-06-16 14:33 | 325K | |
| Cartesianism and Pol..> | 2010-06-16 14:33 | 1.0M | |
| calcom33.pdf | 2010-06-16 14:33 | 1.3M | |
| Capital Siva Natura.pdf | 2010-06-16 14:33 | 102K | |
| calcom32.pdf | 2010-06-16 14:33 | 1.8M | |
| calcom31.pdf | 2010-06-16 14:33 | 1.9M | |
| calcom01.pdf | 2010-06-16 14:33 | 1.5M | |
| bloch.pdf | 2010-06-16 14:33 | 65K | |
| BirthSocialMedicine.pdf | 2010-06-16 14:33 | 17K | |
| Benedicti_de_Spinoza..> | 2010-06-16 14:33 | 15M | |
| Benedict_de_Spinoza.pdf | 2010-06-16 14:32 | 35M | |
| Benedict Spinoza-A P..> | 2010-06-16 14:30 | 1.3M | |
| BecomingMultitude.pdf | 2010-06-16 14:29 | 65K | |
| Baruch Spinoza's Rel..> | 2010-06-16 14:29 | 353K | |
| article.pdf | 2010-06-16 14:29 | 167K | |
| Author.pdf | 2010-06-16 14:29 | 13K | |
| Art, Religion, and t..> | 2010-06-16 14:29 | 383K | |
| Art and the Language..> | 2010-06-16 14:29 | 123K | |
| Apologia12-2000.pdf | 2010-06-16 14:29 | 116K | |
| AO.pdf | 2010-06-16 14:29 | 108K | |
| An_Historical_and_Cr..> | 2010-06-16 14:29 | 8.7M | |
| An Anti-Philosophy o..> | 2010-06-16 14:29 | 186K | |
| Albert Einstein's Ph..> | 2010-06-16 14:29 | 229K | |
| Aeschylus's Physiolo..> | 2010-06-16 14:29 | 507K | |
| A_Refutation_Recentl..> | 2010-06-16 14:29 | 2.5M | |
| A Study of Spinoza a..> | 2010-06-16 14:28 | 563K | |
| A Defense of McTagga..> | 2010-06-16 14:28 | 143K | |
| A Debate concerning ..> | 2010-06-16 14:28 | 814K | |
| A Behaviorist Analys..> | 2010-06-16 14:28 | 1.2M | |
| 113449.pdf | 2010-06-16 14:28 | 70K | |
| 6-1negri.pdf | 2010-06-16 14:28 | 57K | |
| 0On the 'Appropriate..> | 2010-06-16 14:28 | 506K | |
| 0-19-926791-X.pdf | 2010-06-16 14:28 | 110K | |
| works3.pdf | 2010-06-16 14:28 | 1.0M | |
| works2.pdf | 2010-06-16 14:28 | 1.0M | |
| works1.pdf | 2010-06-16 14:28 | 2.4M | |
| William James on the..> | 2010-06-16 14:28 | 243K | |
| Why We Are Responsib..> | 2010-06-16 14:28 | 384K | |
| Why Spinoza Had No A..> | 2010-06-16 14:28 | 211K | |
| What Is Philosophy.pdf | 2010-06-16 14:28 | 152K | |
| What Emotions Are Ab..> | 2010-06-16 14:27 | 475K | |
| Wenck12-2000.pdf | 2010-06-16 14:27 | 119K | |
| VS12-2000.pdf | 2010-06-16 14:27 | 311K | |
| Visions and Meditati..> | 2010-06-16 14:27 | 12M | |
| Vier Bedeutungsebene..> | 2010-06-16 14:27 | 508K | |
| Value and Reality in..> | 2010-06-16 14:27 | 366K | |
| Unconscious and Disg..> | 2010-06-16 14:27 | 330K | |
| TruthPower.pdf | 2010-06-16 14:27 | 18K | |
| Truth%20in%20Fiction..> | 2010-06-16 14:27 | 117K | |
| Transcendence in Spi..> | 2010-06-16 14:27 | 588K | |
| Tractatus_Theologico..> | 2010-06-16 14:26 | 21M | |
| Tractatus_de_Intelle..> | 2010-06-16 14:25 | 3.2M | |
| Toward Integration i..> | 2010-06-16 14:25 | 362K | |
| toscano_spinoza_tehe..> | 2010-06-16 14:25 | 229K | |
| Time and the Hegelia..> | 2010-06-16 14:25 | 408K | |
| Time and the Hegelia..> | 2010-06-16 14:25 | 461K | |
| Thinking with Your H..> | 2010-06-16 14:25 | 553K | |
| Theory-Ladeness and ..> | 2010-06-16 14:25 | 249K | |
| TheolCom12-2000.pdf | 2010-06-16 14:25 | 155K | |
| The_Principles_of_De..> | 2010-06-16 14:25 | 4.0M | |
| The_Philosophy_of_Sp..> | 2010-06-16 14:24 | 3.9M | |
| The_Imagination_in_S..> | 2010-06-16 14:24 | 1.3M | |
| The Unreality of Tim..> | 2010-06-16 14:24 | 489K | |
| The Turn to Emotions..> | 2010-06-16 14:24 | 1.3M | |
| The Spinoza-intoxica..> | 2010-06-16 14:24 | 70K | |
| The Sociology of Emo..> | 2010-06-16 14:24 | 478K | |
| The Romantic Spinoza..> | 2010-06-16 14:24 | 343K | |
| The Religious Elemen..> | 2010-06-16 14:24 | 393K | |
| The Reality of the F..> | 2010-06-16 14:24 | 327K | |
| The Problem of Subst..> | 2010-06-16 14:24 | 427K | |
| The Positive McTagga..> | 2010-06-16 14:24 | 309K | |
| The Plotinian Metaph..> | 2010-06-16 14:24 | 423K | |
| The Place of Laughte..> | 2010-06-16 14:24 | 249K | |
| The Philosophy of do..> | 2010-06-16 14:24 | 1.0M | |
| The Philosophy of Do..> | 2010-06-16 14:24 | 672K | |
| The Philosophy of Do..> | 2010-06-16 14:24 | 853K | |
| The Philosophy of Do..> | 2010-06-16 14:24 | 1.0M | |
| The Philosophy of Do..> | 2010-06-16 14:23 | 669K | |
| The Passivity of Emo..> | 2010-06-16 14:23 | 355K | |
| The Objective Validi..> | 2010-06-16 14:23 | 417K | |
| The Metaphysics of t..> | 2010-06-16 14:23 | 298K | |
| The Meaning of Causa..> | 2010-06-16 14:23 | 535K | |
| The Influence of Mat..> | 2010-06-16 14:23 | 295K | |
| The Idealism of Spin..> | 2010-06-16 14:23 | 301K | |
| The Historical Ethno..> | 2010-06-16 14:23 | 850K | |
| The Gaze Nicholas of..> | 2010-06-16 14:23 | 1.0M | |
| The Fold.pdf | 2010-06-16 14:23 | 379K | |
| The Expression of Em..> | 2010-06-16 14:23 | 424K | |
| The Cultural Orderin..> | 2010-06-16 14:23 | 270K | |
| The Conception of Im..> | 2010-06-16 14:23 | 691K | |
| THE BLESSINGS OF SPI..> | 2010-06-16 14:23 | 69K | |
| The Biological Natur..> | 2010-06-16 14:23 | 797K | |
| The Bergsonian Model..> | 2010-06-16 14:23 | 644K | |
| The Atomic View of M..> | 2010-06-16 14:23 | 710K | |
| The Anthropology of ..> | 2010-06-16 14:23 | 608K | |
| Teleology and the Em..> | 2010-06-16 14:23 | 391K | |
| SubjectPower.pdf | 2010-06-16 14:23 | 22K | |
| Structure of Emotion..> | 2010-06-16 14:23 | 346K | |
| statenaturehobbesspi..> | 2010-06-16 14:23 | 2.6M | |
| SR_1971_Kolakowski.pdf | 2010-06-16 14:23 | 236K | |
| Spinozistic Substanc..> | 2010-06-16 14:23 | 511K | |
| spinozismus.pdf | 2010-06-16 14:23 | 50K | |
| spinozasshorttre00sp..> | 2010-06-16 14:22 | 28M | |
| Spinozafdq.pdf | 2010-06-16 14:21 | 3.3M | |
| Spinozae.pdf | 2010-06-16 14:20 | 5.2M | |
| spinozabuch.pdf | 2010-06-16 14:20 | 199K | |
| Spinozac.pdf | 2010-06-16 14:20 | 117K | |
| Spinoza's Theory of ..> | 2010-06-16 14:20 | 442K | |
| Spinoza's Theologica..> | 2010-06-16 14:20 | 685K | |
| Spinoza's System as ..> | 2010-06-16 14:20 | 671K | |
| Spinoza's Synoptic V..> | 2010-06-16 14:20 | 347K | |
| Spinoza's Political ..> | 2010-06-16 14:20 | 141K | |
| Spinoza's Ontologica..> | 2010-06-16 14:20 | 428K | |
| Spinoza's Monism.pdf | 2010-06-16 14:20 | 464K | |
| Spinoza's Mind-Body ..> | 2010-06-16 14:20 | 236K | |
| Spinoza's Mechanism,..> | 2010-06-16 14:20 | 187K | |
| Spinoza's Doctrine o..> | 2010-06-16 14:20 | 145K | |
| Spinoza's Doctrine o..> | 2010-06-16 14:20 | 414K | |
| Spinoza's Doctrine o..> | 2010-06-16 14:20 | 371K | |
| Spinoza's Distinctio..> | 2010-06-16 14:20 | 206K | |
| Spinoza's Definition..> | 2010-06-16 14:20 | 322K | |
| Spinoza's Conception..> | 2010-06-16 14:20 | 572K | |
| Spinoza's Argument f..> | 2010-06-16 14:20 | 486K | |
| Spinoza.pdf | 2010-06-16 14:20 | 3.0M | |
| Spinoza, Vico, and t..> | 2010-06-16 14:19 | 532K | |
| Spinoza--Beyond Hobb..> | 2010-06-16 14:19 | 429K | |
| Spinoza_precurs_niet..> | 2010-06-16 14:19 | 29K | |
| Spinoza_and_Religion..> | 2010-06-16 14:19 | 5.3M | |
| Spinoza_and_His_Envi..> | 2010-06-16 14:19 | 20M | |
| Spinoza__His_Life_an..> | 2010-06-16 14:18 | 9.7M | |
| Spinoza__a_Handbook_..> | 2010-06-16 14:17 | 5.2M | |
| Spinoza the Jew.pdf | 2010-06-16 14:16 | 438K | |
| Spinoza on the Mind-..> | 2010-06-16 14:16 | 436K | |
| Spinoza on the Essen..> | 2010-06-16 14:16 | 106K | |
| Spinoza on Religious..> | 2010-06-16 14:16 | 323K | |
| Spinoza on God (II).pdf | 2010-06-16 14:16 | 666K | |
| Spinoza on God (I)..pdf | 2010-06-16 14:16 | 377K | |
| Spinoza on Cartesian..> | 2010-06-16 14:16 | 320K | |
| Spinoza in Denmark a..> | 2010-06-16 14:16 | 442K | |
| Spinoza and the Stat..> | 2010-06-16 14:16 | 486K | |
| Spinoza and the Earl..> | 2010-06-16 14:16 | 776K | |
| Spinoza and the Cohe..> | 2010-06-16 14:16 | 368K | |
| Spinoza and Germany.pdf | 2010-06-16 14:16 | 38K | |
| Spinoza and Cartesia..> | 2010-06-16 14:16 | 799K | |
| Spinoza and Cartesia..> | 2010-06-16 14:16 | 1.0M | |
| Spinoza - Wolf.pdf | 2010-06-16 14:16 | 1.4M | |
| http:%2F%2Fplato.sta..> | 2010-06-16 14:16 | 159K | |
| Negri on Sovereignty..> | 2010-06-16 14:16 | 9.5K | |
| Gilles Deleuze - Wik..> | 2010-06-16 14:16 | 439K | |
| Baruch Spinoza (Stan..> | 2010-06-16 14:16 | 143K | |
| an ungrammatical mul..> | 2010-06-16 14:14 | 21K | |
| An Althusserian Lexi..> | 2010-06-16 14:14 | 107K | |
| Amtrak - Reservation..> | 2010-06-16 14:14 | 29K | |
| Althusser's Spinoza.htm | 2010-06-16 14:14 | 36K | |
| Althusser On Aleator..> | 2010-06-16 14:14 | 67K | |
| Althusser and the Re..> | 2010-06-16 14:14 | 1.1K | |
| Althusser and the Re..> | 2010-06-16 14:13 | 1.1K | |
| Althusser and the Re..> | 2010-06-16 14:13 | 1.0K | |
| All 5 entries tagged..> | 2010-06-16 14:13 | 83K | |
| Alain Badiou.htm | 2010-06-16 14:13 | 21K | |
| Alain Badiou-Bibliog..> | 2010-06-16 14:13 | 23K | |
| Affective neuroscien..> | 2010-06-16 14:13 | 28K | |
| Affective States.htm | 2010-06-16 14:13 | 11K | |
| Adventures in Philos..> | 2010-06-16 14:13 | 49K | |
| About Spinoza excerp..> | 2010-06-16 14:13 | 47K | |
| A TREATISE ON GOD AS..> | 2010-06-16 14:13 | 259K | |
| A Thousand Plateaus ..> | 2010-06-16 14:13 | 19K | |
| A Thousand Plateaus ..> | 2010-06-16 14:13 | 16K | |
| A Thousand Plateaus ..> | 2010-06-16 14:13 | 18K | |
| A Thousand Plateaus ..> | 2010-06-16 14:13 | 16K | |
| A Thousand Plateaus ..> | 2010-06-16 14:13 | 71K | |
| A Thousand Plateaus ..> | 2010-06-16 14:13 | 48K | |
| A Thousand Plateaus ..> | 2010-06-16 14:13 | 79K | |
| A Thousand Plateaus ..> | 2010-06-16 14:13 | 16K | |
| A question on divine..> | 2010-06-16 14:13 | 17K | |
| A basic outline of F..> | 2010-06-16 14:13 | 27K | |
| A Theory of Spatial ..> | 2010-06-16 14:13 | 42K | |
| 402-9202464-9021757.htm | 2010-06-16 14:13 | 27K | |
| 20th WCP The Emergen..> | 2010-06-16 14:13 | 95K | |
| 20th WCP Immanence a..> | 2010-06-16 14:13 | 28K | |
| 20th WCP Hobbes, Con..> | 2010-06-16 14:13 | 22K | |
| 20th WCP Bennett on ..> | 2010-06-16 14:13 | 23K | |
| 20th WCP Are Spinozi..> | 2010-06-16 14:13 | 23K | |
| 4_ SPINOZA'S SEMANTI..> | 2010-06-16 14:13 | 66K | |
| _Public Sphere, labo..> | 2010-06-16 14:13 | 17K | |
| Affective neuroscien..> | 2010-06-16 14:03 | - | |
|
|---|
