![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| The Everett Interpre..> | 2002-04-10 20:13 | 141K | |
| The Everett Interpre..> | 2002-04-10 20:13 | 44K | |
| Giordano Bruno On th..> | 2003-10-05 04:41 | 64K | |
| Giordano Bruno On th..> | 2003-10-05 04:41 | 18K | |
| Giordano Bruno On th..> | 2003-10-05 04:41 | 51K | |
| Giordano Bruno On th..> | 2003-10-05 04:41 | 16K | |
| Giordano Bruno On th..> | 2003-10-05 04:41 | 71K | |
| Giordano Bruno On th..> | 2003-10-05 04:41 | 23K | |
| Giordano Bruno On th..> | 2003-10-05 04:41 | 67K | |
| Giordano Bruno On th..> | 2003-10-05 04:41 | 21K | |
| Giordano Bruno On th..> | 2003-10-05 04:42 | 77K | |
| Giordano Bruno On th..> | 2003-10-05 04:42 | 26K | |
| Giordano Bruno On th..> | 2003-10-05 04:42 | 48K | |
| Giordano Bruno On th..> | 2003-10-05 04:42 | 16K | |
| Inflationary Cosmolo..> | 2004-07-01 00:21 | 24K | |
| Inflationary Cosmolo..> | 2004-07-01 00:21 | 9.3K | |
| kant2e.htm | 2004-07-01 04:43 | 352K | |
| kant2e.htm.gz | 2004-07-01 04:43 | 108K | |
| The Web Site of Fran..> | 2004-07-28 06:16 | 15K | |
| The Web Site of Fran..> | 2004-07-28 06:16 | 5.7K | |
| The Web Site of Fran..> | 2004-07-28 06:17 | 52K | |
| The Web Site of Fran..> | 2004-07-28 06:17 | 19K | |
| The Web Site of Fran..> | 2004-07-28 06:17 | 17K | |
| The Web Site of Fran..> | 2004-07-28 06:17 | 6.5K | |
| The Web Site of Fran..> | 2004-07-28 06:18 | 3.3K | |
| The Web Site of Fran..> | 2004-07-28 06:18 | 1.7K | |
| The Tiplerian Scenar..> | 2004-07-28 06:29 | 8.1K | |
| The Tiplerian Scenar..> | 2004-07-28 06:29 | 3.5K | |
| the_black_hole_origi..> | 2004-08-13 06:52 | 59K | |
| the_black_hole_origi..> | 2004-08-13 06:52 | 17K | |
| simplicity_and_why_t..> | 2004-08-13 06:54 | 29K | |
| simplicity_and_why_t..> | 2004-08-13 06:54 | 8.7K | |
| the_anthropic_princi..> | 2004-08-13 06:56 | 80K | |
| the_anthropic_princi..> | 2004-08-13 06:56 | 18K | |
| Leslie.html | 2004-08-13 07:16 | 106K | |
| Leslie.html.gz | 2004-08-13 07:16 | 40K | |
| barrow.html | 2004-08-13 07:25 | 31K | |
| barrow.html.gz | 2004-08-13 07:25 | 11K | |
| x-Ch.15.html | 2004-08-13 07:48 | 36K | |
| x-Ch.15.html.gz | 2004-08-13 07:48 | 13K | |
| z-Ch.17.html | 2004-08-13 07:49 | 45K | |
| z-Ch.17.html.gz | 2004-08-13 07:49 | 15K | |
| stenger_intel.html | 2004-08-13 08:16 | 81K | |
| stenger_intel.html.gz | 2004-08-13 08:16 | 29K | |
| Many Worlds.htm | 2004-08-18 17:43 | 71K | |
| Many Worlds.htm.gz | 2004-08-18 17:43 | 21K | |
| On the Infinite Univ..> | 2004-08-20 19:57 | 43K | |
| On the Infinite Univ..> | 2004-08-20 19:57 | 17K | |
| On the Infinite Univ..> | 2004-08-20 21:35 | 43K | |
| On the Infinite Univ..> | 2004-08-20 21:35 | 17K | |
| Edge THEINFLATIONARY..> | 2007-03-22 05:42 | 32K | |
| Edge THEINFLATIONARY..> | 2007-03-22 05:42 | 9.2K | |
| Cosmology and Theolo..> | 2007-03-22 05:48 | 57K | |
| Cosmology and Theolo..> | 2007-03-22 05:48 | 20K | |
| 1982.pdf | 2007-04-03 18:34 | 645K | |
| 1982.pdf.gz | 2007-04-03 18:34 | 438K | |
| Is the Universe Self..> | 2007-04-10 04:24 | 115K | |
| Is the Universe Self..> | 2007-04-10 04:24 | 97K | |
| Cosmology and Infini..> | 2007-04-10 04:30 | 78K | |
| Cosmology and Infini..> | 2007-04-10 04:30 | 71K | |
| Many Worlds Are Bett..> | 2007-04-10 04:46 | 134K | |
| Many Worlds Are Bett..> | 2007-04-10 04:46 | 115K | |
| Many-Worlds Quantum ..> | 2007-04-15 00:15 | 65K | |
| Many-Worlds Quantum ..> | 2007-04-15 00:15 | 21K | |
| Multiverse Cosmologi..> | 2007-04-15 02:45 | 194K | |
| Multiverse Cosmologi..> | 2007-04-15 02:45 | 183K | |
| Multiverse Scenarios..> | 2007-04-15 02:50 | 342K | |
| Multiverse Scenarios..> | 2007-04-15 02:50 | 324K | |
| Multiverses and Cosm..> | 2007-04-15 02:51 | 341K | |
| Multiverses and Cosm..> | 2007-04-15 02:51 | 300K | |
| Parallel Universes.pdf | 2007-04-15 02:53 | 529K | |
| Parallel Universes.p..> | 2007-04-15 02:53 | 482K | |
| Multiverses and phys..> | 2007-04-15 02:53 | 444K | |
| Multiverses and phys..> | 2007-04-15 02:53 | 396K | |
| Multiverses and Quan..> | 2007-04-15 02:54 | 186K | |
| Multiverses and Quan..> | 2007-04-15 02:54 | 157K | |
| Retroduction, Multiv..> | 2007-04-15 02:58 | 102K | |
| Retroduction, Multiv..> | 2007-04-15 02:58 | 90K | |
| The Measure for the ..> | 2007-04-15 03:10 | 152K | |
| The Measure for the ..> | 2007-04-15 03:10 | 113K | |
| Predictions and Test..> | 2007-04-15 03:18 | 171K | |
| Predictions and Test..> | 2007-04-15 03:18 | 144K | |
| The Structure of the..> | 2007-04-15 03:29 | 421K | |
| The Structure of the..> | 2007-04-15 03:29 | 286K | |
| Edge SMOLIN VS_ SUSS..> | 2007-04-22 04:44 | 146K | |
| Edge SMOLIN VS_ SUSS..> | 2007-04-22 04:44 | 36K | |
| EDGE 3rd Culture Stu..> | 2007-04-22 04:45 | 17K | |
| EDGE 3rd Culture Stu..> | 2007-04-22 04:45 | 6.3K | |
| The Life of the Cosm..> | 2007-04-22 05:01 | 22K | |
| The Life of the Cosm..> | 2007-04-22 05:01 | 8.3K | |
| Thirty one planes of..> | 2007-04-22 05:41 | 49K | |
| Thirty one planes of..> | 2007-04-22 05:41 | 9.7K | |
| Inflation for Beginn..> | 2007-04-22 07:40 | 53K | |
| Inflation for Beginn..> | 2007-04-22 07:40 | 18K | |
| Nicholas of Cusa and..> | 2007-05-04 04:07 | 39K | |
| Nicholas of Cusa and..> | 2007-05-04 04:07 | 14K | |
| Lives.html | 2007-05-31 23:11 | 193K | |
| Lives.html.gz | 2007-05-31 23:11 | 46K | |
| leibdm.pdf | 2007-07-17 01:04 | 238K | |
| leibdm.pdf.gz | 2007-07-17 01:04 | 227K | |
| leibmon.pdf | 2007-07-17 01:05 | 139K | |
| leibmon.pdf.gz | 2007-07-17 01:05 | 132K | |
| DRN_I.html | 2007-08-04 02:14 | 101K | |
| DRN_I.html.gz | 2007-08-04 02:14 | 18K | |
| DRN_II.html | 2007-08-04 02:14 | 88K | |
| DRN_II.html.gz | 2007-08-04 02:14 | 16K | |
| Observership in Cosm..> | 2007-12-25 18:00 | 144K | |
| Observership in Cosm..> | 2007-12-25 18:00 | 126K | |
| Anthropic reasoning ..> | 2007-12-25 18:01 | 88K | |
| Anthropic reasoning ..> | 2007-12-25 18:01 | 74K | |
| Discourse On Metaphy..> | 2007-12-29 21:55 | 121K | |
| Discourse On Metaphy..> | 2007-12-29 21:55 | 38K | |
| Topology of the Univ..> | 2007-12-31 03:17 | 18K | |
| Topology of the Univ..> | 2007-12-31 03:17 | 6.1K | |
| 1883 -- Frederick En..> | 2007-12-31 03:20 | 48K | |
| 1883 -- Frederick En..> | 2007-12-31 03:20 | 18K | |
| The Third Culture - ..> | 2007-12-31 04:35 | 26K | |
| The Third Culture - ..> | 2007-12-31 04:35 | 9.2K | |
| consequences.pdf | 2007-12-31 04:36 | 215K | |
| consequences.pdf.gz | 2007-12-31 04:36 | 126K | |
| Inflation_lself_prod..> | 2007-12-31 04:37 | 544K | |
| Inflation_lself_prod..> | 2007-12-31 04:37 | 527K | |
| Simplicity and Why t..> | 2007-12-31 04:38 | 28K | |
| Simplicity and Why t..> | 2007-12-31 04:38 | 8.8K | |
| FirstScience_com - R..> | 2007-12-31 04:38 | 36K | |
| FirstScience_com - R..> | 2007-12-31 04:38 | 9.0K | |
| Cosmic Search Vol_ 1..> | 2007-12-31 04:40 | 36K | |
| Cosmic Search Vol_ 1..> | 2007-12-31 04:40 | 13K | |
| Evidence for The Big..> | 2007-12-31 04:44 | 138K | |
| Evidence for The Big..> | 2007-12-31 04:44 | 46K | |
| Barrow and Tipler on..> | 2007-12-31 04:49 | 35K | |
| Barrow and Tipler on..> | 2007-12-31 04:49 | 11K | |
| The Pseudo-Problem o..> | 2007-12-31 04:50 | 67K | |
| The Pseudo-Problem o..> | 2007-12-31 04:50 | 24K | |
| A PERSONAL GOD.htm | 2007-12-31 04:50 | 8.7K | |
| A PERSONAL GOD.htm.gz | 2007-12-31 04:50 | 3.6K | |
| Simplicity and Why t..> | 2007-12-31 04:51 | 34K | |
| Simplicity and Why t..> | 2007-12-31 04:51 | 9.0K | |
| The Big Bang.htm | 2007-12-31 05:37 | 18K | |
| The Big Bang.htm.gz | 2007-12-31 05:37 | 6.0K | |
| The_Philosophical_Wo..> | 2008-01-01 07:28 | 13M | |
| The_Philosophical_Wo..> | 2008-01-01 07:28 | 12M | |
| Leibni3.gif | 2008-01-01 07:36 | 315K | |
| Leibni3.gif.gz | 2008-01-01 07:36 | 314K | |
| Leibni4.gif | 2008-01-01 07:37 | 333K | |
| Leibni4.gif.gz | 2008-01-01 07:37 | 332K | |
| Leibni5.gif | 2008-01-01 07:38 | 316K | |
| Leibni5.gif.gz | 2008-01-01 07:38 | 315K | |
| Leibni6.gif | 2008-01-01 07:39 | 315K | |
| Leibni6.gif.gz | 2008-01-01 07:39 | 315K | |
| Leibni7.gif | 2008-01-01 07:40 | 326K | |
| Leibni7.gif.gz | 2008-01-01 07:40 | 325K | |
| Leibni8.gif | 2008-01-01 07:41 | 326K | |
| Leibni8.gif.gz | 2008-01-01 07:41 | 326K | |
| Leibni2.gif | 2008-01-01 07:43 | 277K | |
| Leibni2.gif.gz | 2008-01-01 07:43 | 276K | |
| Leibni1.gif | 2008-01-01 07:45 | 119K | |
| Leibni1.gif.gz | 2008-01-01 07:45 | 118K | |
| Leibni1.JPG | 2008-01-01 07:48 | 735K | |
| Leibni1.JPG.gz | 2008-01-01 07:48 | 457K | |
| Leibni2.JPG | 2008-01-01 07:48 | 1.6M | |
| Leibni2.JPG.gz | 2008-01-01 07:48 | 1.3M | |
| Leibni3.JPG | 2008-01-01 07:48 | 1.9M | |
| Leibni3.JPG.gz | 2008-01-01 07:48 | 1.5M | |
| Leibni4.JPG | 2008-01-01 07:49 | 1.9M | |
| Leibni4.JPG.gz | 2008-01-01 07:49 | 1.6M | |
| Leibni5.JPG | 2008-01-01 07:49 | 1.9M | |
| Leibni5.JPG.gz | 2008-01-01 07:49 | 1.6M | |
| Leibni6.JPG | 2008-01-01 07:49 | 1.9M | |
| Leibni6.JPG.gz | 2008-01-01 07:49 | 1.6M | |
| Leibni7.JPG | 2008-01-01 07:50 | 1.9M | |
| Leibni7.JPG.gz | 2008-01-01 07:50 | 1.6M | |
| Leibni8.JPG | 2008-01-01 07:50 | 1.9M | |
| Leibni8.JPG.gz | 2008-01-01 07:50 | 1.5M | |
| Leibniz - On the Ult..> | 2008-01-01 07:57 | 841 | |
| Leibniz - On the Ult..> | 2008-01-01 07:57 | 373 | |
| Lucretius.html | 2008-01-01 18:09 | 138K | |
| Lucretius.html.gz | 2008-01-01 18:09 | 23K | |
| Nietzsche.htm | 2008-01-01 18:50 | 42K | |
| Nietzsche.htm.gz | 2008-01-01 18:50 | 15K | |
| Simulation, Consciou..> | 2008-01-01 20:41 | 49K | |
| Simulation, Consciou..> | 2008-01-01 20:41 | 19K | |
| The Anthropic Princi..> | 2008-01-01 20:43 | 42K | |
| The Anthropic Princi..> | 2008-01-01 20:43 | 14K | |
| The Mathematical Uni..> | 2008-01-01 20:44 | 61K | |
| The Mathematical Uni..> | 2008-01-01 20:44 | 21K | |
| Simulated Reality Th..> | 2008-01-01 20:45 | 62K | |
| Simulated Reality Th..> | 2008-01-01 20:45 | 20K | |
| An Introduction to Q..> | 2008-01-01 20:47 | 24K | |
| An Introduction to Q..> | 2008-01-01 20:47 | 7.9K | |
| Quantum Indeterminis..> | 2008-01-01 20:47 | 37K | |
| Quantum Indeterminis..> | 2008-01-01 20:47 | 11K | |
| Quantum Entanglement..> | 2008-01-01 20:47 | 43K | |
| Quantum Entanglement..> | 2008-01-01 20:47 | 13K | |
| Quantum Decoherence.htm | 2008-01-01 20:48 | 68K | |
| Quantum Decoherence...> | 2008-01-01 20:48 | 20K | |
| The Copenhagen Inter..> | 2008-01-01 20:48 | 52K | |
| The Copenhagen Inter..> | 2008-01-01 20:48 | 17K | |
| The Standard Model a..> | 2008-01-01 20:49 | 32K | |
| The Standard Model a..> | 2008-01-01 20:49 | 11K | |
| Cosmology, Quantum G..> | 2008-01-01 20:49 | 49K | |
| Cosmology, Quantum G..> | 2008-01-01 20:49 | 15K | |
| What Is Reality.htm | 2008-01-01 20:50 | 11K | |
| What Is Reality.htm.gz | 2008-01-01 20:50 | 3.7K | |
| simulate.pdf | 2008-01-01 20:58 | 212K | |
| simulate.pdf.gz | 2008-01-01 20:58 | 202K | |
| Are You Living in a ..> | 2008-01-01 21:00 | 58K | |
| Are You Living in a ..> | 2008-01-01 21:00 | 17K | |
| barrowsim.pdf | 2008-01-01 21:00 | 120K | |
| barrowsim.pdf.gz | 2008-01-01 21:00 | 103K | |
| Supercomputer Simula..> | 2008-01-01 21:03 | 57K | |
| Supercomputer Simula..> | 2008-01-01 21:03 | 12K | |
| The Space Simulator ..> | 2008-01-01 21:03 | 22K | |
| The Space Simulator ..> | 2008-01-01 21:03 | 5.3K | |
| Simulation of the Un..> | 2008-01-01 21:04 | 58K | |
| Simulation of the Un..> | 2008-01-01 21:04 | 13K | |
| Millennium Simulatio..> | 2008-01-01 21:09 | 25K | |
| Millennium Simulatio..> | 2008-01-01 21:09 | 4.4K | |
| NASA - NASA Achieves..> | 2008-01-01 21:10 | 26K | |
| NASA - NASA Achieves..> | 2008-01-01 21:10 | 7.0K | |
| 0211048v2.pdf | 2008-01-02 06:11 | 337K | |
| 0211048v2.pdf.gz | 2008-01-02 06:11 | 298K | |
| Towards a Coherent T..> | 2008-01-02 06:13 | 349K | |
| Towards a Coherent T..> | 2008-01-02 06:13 | 296K | |
| reality_wigner.pdf | 2008-01-02 06:14 | 108K | |
| reality_wigner.pdf.gz | 2008-01-02 06:14 | 99K | |
| Synopsis of the Leib..> | 2008-01-04 01:02 | 32K | |
| Synopsis of the Leib..> | 2008-01-04 01:02 | 12K | |
| Correspondence with ..> | 2008-01-04 01:03 | 9.9K | |
| Correspondence with ..> | 2008-01-04 01:03 | 3.8K | |
| Correspondence with ..> | 2008-01-04 01:03 | 12K | |
| Correspondence with ..> | 2008-01-04 01:03 | 4.4K | |
| Correspondence with ..> | 2008-01-04 01:03 | 12K | |
| Correspondence with ..> | 2008-01-04 01:03 | 4.5K | |
| Correspondence with ..> | 2008-01-04 01:04 | 12K | |
| Correspondence with ..> | 2008-01-04 01:04 | 4.6K | |
| Correspondence with ..> | 2008-01-04 01:04 | 11K | |
| Correspondence with ..> | 2008-01-04 01:04 | 4.4K | |
| Correspondence with ..> | 2008-01-04 01:04 | 12K | |
| Correspondence with ..> | 2008-01-04 01:04 | 4.1K | |
| Correspondence with ..> | 2008-01-04 01:05 | 12K | |
| Correspondence with ..> | 2008-01-04 01:05 | 4.4K | |
| Correspondence with ..> | 2008-01-04 01:05 | 12K | |
| Correspondence with ..> | 2008-01-04 01:05 | 4.6K | |
| Letter to Arnauld.htm | 2008-01-04 01:23 | 28K | |
| Letter to Arnauld.ht..> | 2008-01-04 01:23 | 9.8K | |
| Arthur C_ Clarke Bib..> | 2008-01-04 03:51 | 7.3K | |
| Arthur C_ Clarke Bib..> | 2008-01-04 03:51 | 2.8K | |
| Final Interview with..> | 2008-01-04 03:57 | 47K | |
| Final Interview with..> | 2008-01-04 03:57 | 19K | |
| Philip K_ Dick on Ph..> | 2008-01-04 03:59 | 11K | |
| Philip K_ Dick on Ph..> | 2008-01-04 03:59 | 4.8K | |
| So I Don't Write Abo..> | 2008-01-04 04:00 | 54K | |
| So I Don't Write Abo..> | 2008-01-04 04:00 | 20K | |
| Sci-Fi Review Interv..> | 2008-01-04 04:01 | 53K | |
| Sci-Fi Review Interv..> | 2008-01-04 04:01 | 20K | |
| Hour 25 Interview A ..> | 2008-01-04 04:02 | 83K | |
| Hour 25 Interview A ..> | 2008-01-04 04:02 | 30K | |
| Arthur C_ Clarke - S..> | 2008-01-04 04:05 | 70K | |
| Arthur C_ Clarke - S..> | 2008-01-04 04:05 | 12K | |
| Robert Anton Wilson ..> | 2008-01-04 04:07 | 16K | |
| Robert Anton Wilson ..> | 2008-01-04 04:07 | 4.8K | |
| Victor Stenger The A..> | 2008-01-05 00:06 | 88K | |
| Victor Stenger The A..> | 2008-01-05 00:06 | 29K | |
| Anthropic Coincidenc..> | 2008-01-05 00:07 | 20K | |
| Anthropic Coincidenc..> | 2008-01-05 00:07 | 6.0K | |
| An Overview of the C..> | 2008-01-05 00:08 | 392K | |
| An Overview of the C..> | 2008-01-05 00:08 | 339K | |
| Frequently Asked Que..> | 2008-01-05 00:09 | 43K | |
| Frequently Asked Que..> | 2008-01-05 00:09 | 14K | |
| The Origin and Devel..> | 2008-01-05 00:10 | 87K | |
| The Origin and Devel..> | 2008-01-05 00:10 | 32K | |
| Remote Sensing Tutor..> | 2008-01-05 00:11 | 115K | |
| Remote Sensing Tutor..> | 2008-01-05 00:11 | 40K | |
| Remote Sensing Tutor..> | 2008-01-05 00:13 | 138K | |
| Remote Sensing Tutor..> | 2008-01-05 00:13 | 46K | |
| The Other Side of Ti..> | 2008-01-05 00:14 | 22K | |
| The Other Side of Ti..> | 2008-01-05 00:14 | 7.3K | |
| Time before Time.pdf | 2008-01-05 00:14 | 282K | |
| Time before Time.pdf.gz | 2008-01-05 00:14 | 222K | |
| Galaxies and the Uni..> | 2008-01-05 00:17 | 14K | |
| Galaxies and the Uni..> | 2008-01-05 00:17 | 6.0K | |
| Remote Sensing Tutor..> | 2008-01-05 00:17 | 70K | |
| Remote Sensing Tutor..> | 2008-01-05 00:17 | 23K | |
| Untitled.htm | 2008-01-05 00:17 | 77K | |
| Untitled.htm.gz | 2008-01-05 00:17 | 26K | |
| Remote Sensing Tutor..> | 2008-01-05 00:18 | 40K | |
| Remote Sensing Tutor..> | 2008-01-05 00:18 | 15K | |
| Causation and the Lo..> | 2008-01-05 00:19 | 69K | |
| Causation and the Lo..> | 2008-01-05 00:19 | 21K | |
| Internal and Externa..> | 2008-01-05 00:19 | 65K | |
| Internal and Externa..> | 2008-01-05 00:19 | 20K | |
| Is Our Universe a Me..> | 2008-01-05 00:20 | 189K | |
| Is Our Universe a Me..> | 2008-01-05 00:20 | 169K | |
| Many-Worlds Interpre..> | 2008-01-09 18:30 | 80K | |
| Many-Worlds Interpre..> | 2008-01-09 18:30 | 22K | |
| 1883 -- Frederick En..> | 2008-01-25 01:42 | - | |
| A PERSONAL GOD_files/ | 2008-01-25 01:42 | - | |
| An Introduction to Q..> | 2008-01-25 01:42 | - | |
| Are You Living in a ..> | 2008-01-25 01:42 | - | |
| Arthur C_ Clarke - S..> | 2008-01-25 01:42 | - | |
| Arthur C_ Clarke Bib..> | 2008-01-25 01:42 | - | |
| Barrow and Tipler on..> | 2008-01-25 01:42 | - | |
| Correspondence with ..> | 2008-01-25 01:42 | - | |
| Correspondence with ..> | 2008-01-25 01:42 | - | |
| Correspondence with ..> | 2008-01-25 01:42 | - | |
| Correspondence with ..> | 2008-01-25 01:42 | - | |
| Correspondence with ..> | 2008-01-25 01:42 | - | |
| Correspondence with ..> | 2008-01-25 01:42 | - | |
| Correspondence with ..> | 2008-01-25 01:42 | - | |
| Correspondence with ..> | 2008-01-25 01:42 | - | |
| Cosmic Search Vol_ 1..> | 2008-01-25 01:42 | - | |
| Cosmology and Theolo..> | 2008-01-25 01:42 | - | |
| Cosmology, Quantum G..> | 2008-01-25 01:43 | - | |
| EDGE 3rd Culture Stu..> | 2008-01-25 01:43 | - | |
| Edge SMOLIN VS_ SUSS..> | 2008-01-25 01:43 | - | |
| Edge THEINFLATIONARY..> | 2008-01-25 01:43 | - | |
| Evidence for The Big..> | 2008-01-25 01:43 | - | |
| FirstScience_com - R..> | 2008-01-25 01:43 | - | |
| Frequently Asked Que..> | 2008-01-25 01:43 | - | |
| Galaxies and the Uni..> | 2008-01-25 01:43 | - | |
| Giordano Bruno On th..> | 2008-01-25 01:43 | - | |
| Giordano Bruno On th..> | 2008-01-25 01:43 | - | |
| Giordano Bruno On th..> | 2008-01-25 01:43 | - | |
| Giordano Bruno On th..> | 2008-01-25 01:43 | - | |
| Giordano Bruno On th..> | 2008-01-25 01:43 | - | |
| Giordano Bruno On th..> | 2008-01-25 01:43 | - | |
| Hour 25 Interview A ..> | 2008-01-25 01:43 | - | |
| Inflation for Beginn..> | 2008-01-25 01:43 | - | |
| Inflationary Cosmolo..> | 2008-01-25 01:43 | - | |
| Leibniz-Arnauld/ | 2008-01-25 01:44 | - | |
| Many-Worlds Interpre..> | 2008-01-25 01:44 | - | |
| Many-Worlds Quantum ..> | 2008-01-25 01:44 | - | |
| Millennium Simulatio..> | 2008-01-25 01:44 | - | |
| NASA - NASA Achieves..> | 2008-01-25 01:45 | - | |
| Nicholas of Cusa and..> | 2008-01-25 01:45 | - | |
| Quantum Decoherence_..> | 2008-01-25 01:45 | - | |
| Quantum Entanglement..> | 2008-01-25 01:45 | - | |
| Quantum Indeterminis..> | 2008-01-25 01:45 | - | |
| Remote Sensing Tutor..> | 2008-01-25 01:46 | - | |
| Remote Sensing Tutor..> | 2008-01-25 01:46 | - | |
| Remote Sensing Tutor..> | 2008-01-25 01:47 | - | |
| Remote Sensing Tutor..> | 2008-01-25 01:48 | - | |
| Robert Anton Wilson ..> | 2008-01-25 01:48 | - | |
| Simplicity and Why t..> | 2008-01-25 01:48 | - | |
| Simplicity and Why t..> | 2008-01-25 01:48 | - | |
| Simulated Reality Th..> | 2008-01-25 01:48 | - | |
| So I Don't Write Abo..> | 2008-01-25 01:48 | - | |
| Stapledon/ | 2008-01-25 01:48 | - | |